C14H12N2O3 — CID 174848999
2-amino-2-nitro-1,2-diphenylethanone (PubChem CID 174848999) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-amino-2-nitro-1,2-diphenylethanone.
| Compound Name | 2-amino-2-nitro-1,2-diphenylethanone |
|---|---|
| PubChem CID | 174848999 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-amino-2-nitro-1,2-diphenylethanone |
| SMILES | NC(C(=O)c1ccccc1)(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N2O3/c15-14(16(18)19,12-9-5-2-6-10-12)13(17)11-7-3-1-4-8-11/h1-10H,15H2 |
| InChIKey | ZKKWVNAMXMMQJQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|