C13H11NO10 — CID 151299678
2-hydroxy-3-nitro-4-oxo-4-phenylbutane-1,2,3-tricarboxylic acid (PubChem CID 151299678) has the molecular formula C13H11NO10 and a molecular weight of 341.23 g/mol. Its IUPAC name is 2-hydroxy-3-nitro-4-oxo-4-phenylbutane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-3-nitro-4-oxo-4-phenylbutane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 151299678 |
| Molecular Formula | C13H11NO10 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-hydroxy-3-nitro-4-oxo-4-phenylbutane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(C(=O)O)C(C(=O)O)(C(=O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H11NO10/c15-8(16)6-12(22,10(18)19)13(11(20)21,14(23)24)9(17)7-4-2-1-3-5-7/h1-5,22H,6H2,(H,15,16)(H,18,19)(H,20,21) |
| InChIKey | OCDUFWRHLNCYLO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 192.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|