C27H29NO — CID 175544554
N-(2,2-dimethyl-3,4-diphenylhex-5-en-3-yl)benzamide (PubChem CID 175544554) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is N-(2,2-dimethyl-3,4-diphenylhex-5-en-3-yl)benzamide.
| Compound Name | N-(2,2-dimethyl-3,4-diphenylhex-5-en-3-yl)benzamide |
|---|---|
| PubChem CID | 175544554 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-(2,2-dimethyl-3,4-diphenylhex-5-en-3-yl)benzamide |
| SMILES | C=CC(c1ccccc1)C(NC(=O)c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H29NO/c1-5-24(21-15-9-6-10-16-21)27(26(2,3)4,23-19-13-8-14-20-23)28-25(29)22-17-11-7-12-18-22/h5-20,24H,1H2,2-4H3,(H,28,29) |
| InChIKey | SGYKFYUSDXULMV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|