C13H11NO — CID 123305051
(2Z,4E)-5-(4-isocyanophenyl)-3-methylpenta-2,4-dienal (PubChem CID 123305051) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (2Z,4E)-5-(4-isocyanophenyl)-3-methylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-5-(4-isocyanophenyl)-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 123305051 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (2Z,4E)-5-(4-isocyanophenyl)-3-methylpenta-2,4-dienal |
| SMILES | [C-]#[N+]c1ccc(/C=C/C(C)=C\C=O)cc1 |
| InChI | InChI=1S/C13H11NO/c1-11(9-10-15)3-4-12-5-7-13(14-2)8-6-12/h3-10H,1H3/b4-3+,11-9- |
| InChIKey | UABLDPLFRNYTTD-XVRQLKFYSA-N |
| XLogP | 3.40 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|