C10H10OS — CID 10678894
(2Z,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dienal (PubChem CID 10678894) has the molecular formula C10H10OS and a molecular weight of 178.26 g/mol. Its IUPAC name is (2Z,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dienal |
|---|---|
| PubChem CID | 10678894 |
| Molecular Formula | C10H10OS |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (2Z,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dienal |
| SMILES | CC(=C/C=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C10H10OS/c1-9(6-7-11)4-5-10-3-2-8-12-10/h2-8H,1H3/b5-4+,9-6- |
| InChIKey | RXINRHPBSKIGFG-WEHQGULRSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|