C34H46O3SSi — CID 23244859
triethoxy-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-5,9,14,18-tetramethyl-20-thiophen-2-ylicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]silane (PubChem CID 23244859) has the molecular formula C34H46O3SSi and a molecular weight of 562.89 g/mol. Its IUPAC name is triethoxy-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-5,9,14,18-tetramethyl-20-thiophen-2-ylicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]silane.
| Compound Name | triethoxy-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-5,9,14,18-tetramethyl-20-thiophen-2-ylicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]silane |
|---|---|
| PubChem CID | 23244859 |
| Molecular Formula | C34H46O3SSi |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | triethoxy-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-5,9,14,18-tetramethyl-20-thiophen-2-ylicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]silane |
| SMILES | CCO[Si](/C=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/c1cccs1)(OCC)OCC |
| InChI | InChI=1S/C34H46O3SSi/c1-8-35-39(36-9-2,37-10-3)29-14-13-20-32(6)22-15-21-30(4)18-11-12-19-31(5)23-16-24-33(7)26-27-34-25-17-28-38-34/h11-29H,8-10H2,1-7H3/b12-11+,20-13+,21-15+,23-16+,27-26+,29-14+,30-18+,31-19+,32-22+,33-24+ |
| InChIKey | DATGZIQBUWPQJL-DXKXCMKMSA-N |
| XLogP | 9.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|