About 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine
2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine (PubChem CID 165407962) has the molecular formula C18H28N2O2S
and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine |
| PubChem CID | 165407962 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine |
| SMILES | CCCC(=O)OCCN(C)C.[H]/N=C/C=C(C)/C=C/c1cccs1 |
| InChI | InChI=1S/C10H11NS.C8H17NO2/c1-9(6-7-11)4-5-10-3-2-8-12-10;1-4-5-8(10)11-7-6-9(2)3/h2-8,11H,1H3;4-7H2,1-3H3/b5-4+,9-6+,11-7+; |
| InChIKey | GLRAUGICGQMOJN-VOLJNXJNSA-N |
| XLogP | 4.25 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine?
The IUPAC name of 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine (CID 165407962) is 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine.
What is the SMILES notation for 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine?
The canonical SMILES for 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine is CCCC(=O)OCCN(C)C.[H]/N=C/C=C(C)/C=C/c1cccs1.
What is the InChIKey of 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine?
The InChIKey is GLRAUGICGQMOJN-VOLJNXJNSA-N. The full InChI is InChI=1S/C10H11NS.C8H17NO2/c1-9(6-7-11)4-5-10-3-2-8-12-10;1-4-5-8(10)11-7-6-9(2)3/h2-8,11H,1H3;4-7H2,1-3H3/b5-4+,9-6+,11-7+;.
What are the key properties of 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine?
2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine has a molecular weight of 336.50 g/mol, XLogP of 4.25, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl butanoate;(2E,4E)-3-methyl-5-thiophen-2-ylpenta-2,4-dien-1-imine is sourced from PubChem (CID 165407962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).