2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate

C10H12O2S2 — CID 78790183

IUPAC2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate
SMILESCSCCOC(=O)/C=C/c1cccs1
InChIInChI=1S/C10H12O2S2/c1-13-8-6-12-10(11)5-4-9-3-2-7-14-9/h2-5,7H,6,8H2,1H3/b5-4+
InChIKeyKZOOYYZBUKRJRR-SNAWJCMRSA-N
MW228.34 g/mol
LogP2.67
Rot. Bonds5

About 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate

2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 78790183) has the molecular formula C10H12O2S2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate.

Molecular Properties

Compound Name2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate
PubChem CID78790183
Molecular FormulaC10H12O2S2
Molecular Weight228.34 g/mol
Exact Mass228.03
IUPAC Name2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate
SMILESCSCCOC(=O)/C=C/c1cccs1
InChIInChI=1S/C10H12O2S2/c1-13-8-6-12-10(11)5-4-9-3-2-7-14-9/h2-5,7H,6,8H2,1H3/b5-4+
InChIKeyKZOOYYZBUKRJRR-SNAWJCMRSA-N
XLogP2.67
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.34
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate?
The IUPAC name of 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate (CID 78790183) is 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate.
What is the SMILES notation for 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate?
The canonical SMILES for 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate is CSCCOC(=O)/C=C/c1cccs1.
What is the InChIKey of 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate?
The InChIKey is KZOOYYZBUKRJRR-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H12O2S2/c1-13-8-6-12-10(11)5-4-9-3-2-7-14-9/h2-5,7H,6,8H2,1H3/b5-4+.
What are the key properties of 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate?
2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate has a molecular weight of 228.34 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl (E)-3-thiophen-2-ylprop-2-enoate is sourced from PubChem (CID 78790183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).