C18H18O3S — CID 3994895
[2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-thiophen-2-ylprop-2-enoate (PubChem CID 3994895) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 3994895 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylphenyl)ethyl] 3-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)C=Cc2cccs2)c(C)c1 |
| InChI | InChI=1S/C18H18O3S/c1-12-9-13(2)18(14(3)10-12)16(19)11-21-17(20)7-6-15-5-4-8-22-15/h4-10H,11H2,1-3H3 |
| InChIKey | BGLIKCINRONJKK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|