C11H9NOS2 — CID 47028560
(E)-1-(4-methyl-1,3-thiazol-5-yl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 47028560) has the molecular formula C11H9NOS2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (E)-1-(4-methyl-1,3-thiazol-5-yl)-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(4-methyl-1,3-thiazol-5-yl)-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 47028560 |
| Molecular Formula | C11H9NOS2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | (E)-1-(4-methyl-1,3-thiazol-5-yl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | Cc1ncsc1C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C11H9NOS2/c1-8-11(15-7-12-8)10(13)5-4-9-3-2-6-14-9/h2-7H,1H3/b5-4+ |
| InChIKey | PTGAZSUYDOOGTL-SNAWJCMRSA-N |
| XLogP | 3.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|