C14H12NO3S- — CID 9187759
3,5-dimethyl-4-[(E)-3-thiophen-2-ylprop-2-enoyl]-1H-pyrrole-2-carboxylate (PubChem CID 9187759) has the molecular formula C14H12NO3S- and a molecular weight of 274.32 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(E)-3-thiophen-2-ylprop-2-enoyl]-1H-pyrrole-2-carboxylate.
| Compound Name | 3,5-dimethyl-4-[(E)-3-thiophen-2-ylprop-2-enoyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9187759 |
| Molecular Formula | C14H12NO3S- |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3,5-dimethyl-4-[(E)-3-thiophen-2-ylprop-2-enoyl]-1H-pyrrole-2-carboxylate |
| SMILES | Cc1[nH]c(C(=O)[O-])c(C)c1C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C14H13NO3S/c1-8-12(9(2)15-13(8)14(17)18)11(16)6-5-10-4-3-7-19-10/h3-7,15H,1-2H3,(H,17,18)/p-1/b6-5+ |
| InChIKey | GIXQATNSRNXIDY-AATRIKPKSA-M |
| XLogP | 1.95 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|