C21H24NO5- — CID 9188037
4-[(E)-3-[4-methoxy-3-(2-methylpropoxy)phenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 9188037) has the molecular formula C21H24NO5- and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[(E)-3-[4-methoxy-3-(2-methylpropoxy)phenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | 4-[(E)-3-[4-methoxy-3-(2-methylpropoxy)phenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9188037 |
| Molecular Formula | C21H24NO5- |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[(E)-3-[4-methoxy-3-(2-methylpropoxy)phenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COc1ccc(/C=C/C(=O)c2c(C)[nH]c(C(=O)[O-])c2C)cc1OCC(C)C |
| InChI | InChI=1S/C21H25NO5/c1-12(2)11-27-18-10-15(7-9-17(18)26-5)6-8-16(23)19-13(3)20(21(24)25)22-14(19)4/h6-10,12,22H,11H2,1-5H3,(H,24,25)/p-1/b8-6+ |
| InChIKey | BMBOCLUAVXQPCU-SOFGYWHQSA-M |
| XLogP | 2.93 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|