C21H23N2O6- — CID 9188041
4-[(E)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 9188041) has the molecular formula C21H23N2O6- and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-[(E)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | 4-[(E)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9188041 |
| Molecular Formula | C21H23N2O6- |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-[(E)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCNC(=O)COc1ccc(/C=C/C(=O)c2c(C)[nH]c(C(=O)[O-])c2C)cc1OC |
| InChI | InChI=1S/C21H24N2O6/c1-5-22-18(25)11-29-16-9-7-14(10-17(16)28-4)6-8-15(24)19-12(2)20(21(26)27)23-13(19)3/h6-10,23H,5,11H2,1-4H3,(H,22,25)(H,26,27)/p-1/b8-6+ |
| InChIKey | LOJZEGRAFALFCN-SOFGYWHQSA-M |
| XLogP | 1.41 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|