C22H25NO6 — CID 7947909
2-[4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-N-ethylacetamide (PubChem CID 7947909) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-N-ethylacetamide.
| Compound Name | 2-[4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 7947909 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[4-[(E)-3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(/C=C/C(=O)c2cc(OC)ccc2OC)cc1OC |
| InChI | InChI=1S/C22H25NO6/c1-5-23-22(25)14-29-20-10-7-15(12-21(20)28-4)6-9-18(24)17-13-16(26-2)8-11-19(17)27-3/h6-13H,5,14H2,1-4H3,(H,23,25)/b9-6+ |
| InChIKey | OTRVJAKRSYCPLF-RMKNXTFCSA-N |
| XLogP | 3.12 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|