C18H17F2NO5 — CID 9187938
4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid (PubChem CID 9187938) has the molecular formula C18H17F2NO5 and a molecular weight of 365.33 g/mol. Its IUPAC name is 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 9187938 |
| Molecular Formula | C18H17F2NO5 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
| SMILES | COc1cc(/C=C/C(=O)c2c(C)[nH]c(C(=O)O)c2C)ccc1OC(F)F |
| InChI | InChI=1S/C18H17F2NO5/c1-9-15(10(2)21-16(9)17(23)24)12(22)6-4-11-5-7-13(26-18(19)20)14(8-11)25-3/h4-8,18,21H,1-3H3,(H,23,24)/b6-4+ |
| InChIKey | GFZBTKLMJIGLKI-GQCTYLIASA-N |
| XLogP | 3.84 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|