C17H16BrNO4 — CID 9187876
4-[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid (PubChem CID 9187876) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is 4-[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 9187876 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 4-[(E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)c1c(C)[nH]c(C(=O)O)c1C |
| InChI | InChI=1S/C17H16BrNO4/c1-9-15(10(2)19-16(9)17(21)22)13(20)6-4-11-8-12(18)5-7-14(11)23-3/h4-8,19H,1-3H3,(H,21,22)/b6-4+ |
| InChIKey | RERMSLDYTGCEMF-GQCTYLIASA-N |
| XLogP | 4.00 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|