C17H14F3NO3 — CID 9187823
3,5-dimethyl-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 9187823) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3,5-dimethyl-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 9187823 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3,5-dimethyl-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1[nH]c(C(=O)O)c(C)c1C(=O)/C=C/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H14F3NO3/c1-9-14(10(2)21-15(9)16(23)24)13(22)8-7-11-5-3-4-6-12(11)17(18,19)20/h3-8,21H,1-2H3,(H,23,24)/b8-7+ |
| InChIKey | PPHMEECBVHTTKI-BQYQJAHWSA-N |
| XLogP | 4.24 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|