C23H19F3O — CID 121364385
(2E,4E,6Z,8E)-3-methyl-7-phenyl-9-[4-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenal (PubChem CID 121364385) has the molecular formula C23H19F3O and a molecular weight of 368.40 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-3-methyl-7-phenyl-9-[4-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6Z,8E)-3-methyl-7-phenyl-9-[4-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 121364385 |
| Molecular Formula | C23H19F3O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2E,4E,6Z,8E)-3-methyl-7-phenyl-9-[4-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenal |
| SMILES | CC(/C=C/C=C(/C=C/c1ccc(C(F)(F)F)cc1)c1ccccc1)=C\C=O |
| InChI | InChI=1S/C23H19F3O/c1-18(16-17-27)6-5-9-21(20-7-3-2-4-8-20)13-10-19-11-14-22(15-12-19)23(24,25)26/h2-17H,1H3/b6-5+,13-10+,18-16+,21-9- |
| InChIKey | RTCBZELCIGMCJJ-FYHRZTQGSA-N |
| XLogP | 6.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|