C25H24O4 — CID 121364402
[4-[(1E,3Z,5E,7E)-3-(4-methoxyphenyl)-7-methyl-9-oxonona-1,3,5,7-tetraenyl]phenyl] acetate (PubChem CID 121364402) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is [4-[(1E,3Z,5E,7E)-3-(4-methoxyphenyl)-7-methyl-9-oxonona-1,3,5,7-tetraenyl]phenyl] acetate.
| Compound Name | [4-[(1E,3Z,5E,7E)-3-(4-methoxyphenyl)-7-methyl-9-oxonona-1,3,5,7-tetraenyl]phenyl] acetate |
|---|---|
| PubChem CID | 121364402 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [4-[(1E,3Z,5E,7E)-3-(4-methoxyphenyl)-7-methyl-9-oxonona-1,3,5,7-tetraenyl]phenyl] acetate |
| SMILES | COc1ccc(C(=C\C=C\C(C)=C\C=O)/C=C/c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C25H24O4/c1-19(17-18-26)5-4-6-22(23-11-15-24(28-3)16-12-23)10-7-21-8-13-25(14-9-21)29-20(2)27/h4-18H,1-3H3/b5-4+,10-7+,19-17+,22-6- |
| InChIKey | XTEMIIBOFPHGPP-QSYJOQHBSA-N |
| XLogP | 5.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|