C22H24N2O — CID 121373949
(2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-pyridin-3-ylnona-2,4,6,8-tetraen-1-amine (PubChem CID 121373949) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-pyridin-3-ylnona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-pyridin-3-ylnona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373949 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-pyridin-3-ylnona-2,4,6,8-tetraen-1-amine |
| SMILES | COc1ccc(C(=C\C=C\C(C)=C\CN)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C22H24N2O/c1-18(14-15-23)5-3-7-20(9-8-19-6-4-16-24-17-19)21-10-12-22(25-2)13-11-21/h3-14,16-17H,15,23H2,1-2H3/b5-3+,9-8+,18-14+,20-7- |
| InChIKey | KFCRMXROMGRYNW-ZBTMZJOKSA-N |
| XLogP | 4.65 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|