C23H29NO — CID 121373917
(2E,4E,6Z,8E)-9-(cyclohexen-1-yl)-7-(4-methoxyphenyl)-3-methylnona-2,4,6,8-tetraen-1-amine (PubChem CID 121373917) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-9-(cyclohexen-1-yl)-7-(4-methoxyphenyl)-3-methylnona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6Z,8E)-9-(cyclohexen-1-yl)-7-(4-methoxyphenyl)-3-methylnona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373917 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2E,4E,6Z,8E)-9-(cyclohexen-1-yl)-7-(4-methoxyphenyl)-3-methylnona-2,4,6,8-tetraen-1-amine |
| SMILES | COc1ccc(C(=C\C=C\C(C)=C\CN)/C=C/C2=CCCCC2)cc1 |
| InChI | InChI=1S/C23H29NO/c1-19(17-18-24)7-6-10-21(12-11-20-8-4-3-5-9-20)22-13-15-23(25-2)16-14-22/h6-8,10-17H,3-5,9,18,24H2,1-2H3/b7-6+,12-11+,19-17+,21-10- |
| InChIKey | PRZVTXWTYJEYIG-JQPJPVIESA-N |
| XLogP | 5.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|