C23H32 — CID 158225433
6-[(3E,5E,7E)-2,2,7-trimethyldeca-3,5,7-trien-3-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 158225433) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 6-[(3E,5E,7E)-2,2,7-trimethyldeca-3,5,7-trien-3-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[(3E,5E,7E)-2,2,7-trimethyldeca-3,5,7-trien-3-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 158225433 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 6-[(3E,5E,7E)-2,2,7-trimethyldeca-3,5,7-trien-3-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC/C=C(C)/C=C/C=C(/c1ccc2c(c1)CCCC2)C(C)(C)C |
| InChI | InChI=1S/C23H32/c1-6-10-18(2)11-9-14-22(23(3,4)5)21-16-15-19-12-7-8-13-20(19)17-21/h9-11,14-17H,6-8,12-13H2,1-5H3/b11-9+,18-10+,22-14- |
| InChIKey | RNRKINWQOKZWIK-WMMJNGJXSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|