C14H18N2O2 — CID 135521883
N-[1-hydroxyimino-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-ylidene]hydroxylamine (PubChem CID 135521883) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-[1-hydroxyimino-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | N-[1-hydroxyimino-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135521883 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-[1-hydroxyimino-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CCC(=NO)C(=NO)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H18N2O2/c1-2-13(15-17)14(16-18)12-8-7-10-5-3-4-6-11(10)9-12/h7-9,17-18H,2-6H2,1H3 |
| InChIKey | IASHQMMTVLHSGK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|