C14H15N — CID 82076208
(Z)-2-(2,3-dihydro-1H-inden-5-yl)pent-2-enenitrile (PubChem CID 82076208) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is (Z)-2-(2,3-dihydro-1H-inden-5-yl)pent-2-enenitrile.
| Compound Name | (Z)-2-(2,3-dihydro-1H-inden-5-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 82076208 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (Z)-2-(2,3-dihydro-1H-inden-5-yl)pent-2-enenitrile |
| SMILES | CC/C=C(\C#N)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H15N/c1-2-4-14(10-15)13-8-7-11-5-3-6-12(11)9-13/h4,7-9H,2-3,5-6H2,1H3/b14-4+ |
| InChIKey | KVXBLHSQSHKZRC-LNKIKWGQSA-N |
| XLogP | 3.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|