C15H15N3O — CID 60680530
2-[cyanomethyl-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]amino]acetonitrile (PubChem CID 60680530) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[cyanomethyl-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 60680530 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[cyanomethyl-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]amino]acetonitrile |
| SMILES | N#CCN(CC#N)CC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H15N3O/c16-6-8-18(9-7-17)11-15(19)14-5-4-12-2-1-3-13(12)10-14/h4-5,10H,1-3,8-9,11H2 |
| InChIKey | LXXWWJWNDGTBSZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|