C16H17NO2 — CID 158825253
ethyl (2E,4E)-5-(4-isocyanophenyl)-2,4-dimethylpenta-2,4-dienoate (PubChem CID 158825253) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(4-isocyanophenyl)-2,4-dimethylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(4-isocyanophenyl)-2,4-dimethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 158825253 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl (2E,4E)-5-(4-isocyanophenyl)-2,4-dimethylpenta-2,4-dienoate |
| SMILES | [C-]#[N+]c1ccc(/C=C(C)/C=C(\C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-5-19-16(18)13(3)10-12(2)11-14-6-8-15(17-4)9-7-14/h6-11H,5H2,1-3H3/b12-11+,13-10+ |
| InChIKey | AEUWMEHZRGIYFZ-JASOSIDASA-N |
| XLogP | 4.15 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|