C20H27FO2 — CID 142405635
ethyl (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methyldec-2-enoate (PubChem CID 142405635) has the molecular formula C20H27FO2 and a molecular weight of 318.43 g/mol. Its IUPAC name is ethyl (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methyldec-2-enoate.
| Compound Name | ethyl (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methyldec-2-enoate |
|---|---|
| PubChem CID | 142405635 |
| Molecular Formula | C20H27FO2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | ethyl (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methyldec-2-enoate |
| SMILES | CCCCCCC(=C\c1ccc(F)cc1)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C20H27FO2/c1-4-6-7-8-9-18(14-16(3)20(22)23-5-2)15-17-10-12-19(21)13-11-17/h10-15H,4-9H2,1-3H3/b16-14+,18-15+ |
| InChIKey | RLKRWASORBIUQX-FLNGBNSUSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|