C18H23FO — CID 167589505
(E,6E)-6-[(4-fluorophenyl)methylidene]undec-4-en-3-one (PubChem CID 167589505) has the molecular formula C18H23FO and a molecular weight of 274.38 g/mol. Its IUPAC name is (E,6E)-6-[(4-fluorophenyl)methylidene]undec-4-en-3-one.
| Compound Name | (E,6E)-6-[(4-fluorophenyl)methylidene]undec-4-en-3-one |
|---|---|
| PubChem CID | 167589505 |
| Molecular Formula | C18H23FO |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (E,6E)-6-[(4-fluorophenyl)methylidene]undec-4-en-3-one |
| SMILES | CCCCCC(/C=C/C(=O)CC)=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FO/c1-3-5-6-7-15(10-13-18(20)4-2)14-16-8-11-17(19)12-9-16/h8-14H,3-7H2,1-2H3/b13-10+,15-14+ |
| InChIKey | IGAQKJGMARZDTG-HFEXRDJISA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|