C23H26O — CID 19571079
(E,4Z)-4-benzylidene-1-(3-methylphenyl)non-2-en-1-one (PubChem CID 19571079) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is (E,4Z)-4-benzylidene-1-(3-methylphenyl)non-2-en-1-one.
| Compound Name | (E,4Z)-4-benzylidene-1-(3-methylphenyl)non-2-en-1-one |
|---|---|
| PubChem CID | 19571079 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (E,4Z)-4-benzylidene-1-(3-methylphenyl)non-2-en-1-one |
| SMILES | CCCCCC(=C/c1ccccc1)/C=C/C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C23H26O/c1-3-4-6-11-21(18-20-12-7-5-8-13-20)15-16-23(24)22-14-9-10-19(2)17-22/h5,7-10,12-18H,3-4,6,11H2,1-2H3/b16-15+,21-18- |
| InChIKey | PFWDVGITBAWFIV-UKIMGHMZSA-N |
| XLogP | 6.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|