C25H26N2O — CID 19541231
(E,4Z)-4-benzylidene-1-(4-imidazol-1-ylphenyl)non-2-en-1-one (PubChem CID 19541231) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is (E,4Z)-4-benzylidene-1-(4-imidazol-1-ylphenyl)non-2-en-1-one.
| Compound Name | (E,4Z)-4-benzylidene-1-(4-imidazol-1-ylphenyl)non-2-en-1-one |
|---|---|
| PubChem CID | 19541231 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (E,4Z)-4-benzylidene-1-(4-imidazol-1-ylphenyl)non-2-en-1-one |
| SMILES | CCCCCC(=C/c1ccccc1)/C=C/C(=O)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C25H26N2O/c1-2-3-5-8-22(19-21-9-6-4-7-10-21)11-16-25(28)23-12-14-24(15-13-23)27-18-17-26-20-27/h4,6-7,9-20H,2-3,5,8H2,1H3/b16-11+,22-19- |
| InChIKey | OQNXWYCJEPJMPY-NZQUJZJYSA-N |
| XLogP | 6.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|