C20H23ClN2O — CID 19567417
(E,4Z)-4-benzylidene-1-(4-chloro-1-methylpyrazol-3-yl)non-2-en-1-one (PubChem CID 19567417) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is (E,4Z)-4-benzylidene-1-(4-chloro-1-methylpyrazol-3-yl)non-2-en-1-one.
| Compound Name | (E,4Z)-4-benzylidene-1-(4-chloro-1-methylpyrazol-3-yl)non-2-en-1-one |
|---|---|
| PubChem CID | 19567417 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (E,4Z)-4-benzylidene-1-(4-chloro-1-methylpyrazol-3-yl)non-2-en-1-one |
| SMILES | CCCCCC(=C/c1ccccc1)/C=C/C(=O)c1nn(C)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O/c1-3-4-6-9-17(14-16-10-7-5-8-11-16)12-13-19(24)20-18(21)15-23(2)22-20/h5,7-8,10-15H,3-4,6,9H2,1-2H3/b13-12+,17-14- |
| InChIKey | OYUKNQJZSDGDBV-SQCSQLHISA-N |
| XLogP | 5.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|