C28H27NOS — CID 19544577
(E,4Z)-4-benzylidene-1-(10H-phenothiazin-2-yl)non-2-en-1-one (PubChem CID 19544577) has the molecular formula C28H27NOS and a molecular weight of 425.60 g/mol. Its IUPAC name is (E,4Z)-4-benzylidene-1-(10H-phenothiazin-2-yl)non-2-en-1-one.
| Compound Name | (E,4Z)-4-benzylidene-1-(10H-phenothiazin-2-yl)non-2-en-1-one |
|---|---|
| PubChem CID | 19544577 |
| Molecular Formula | C28H27NOS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (E,4Z)-4-benzylidene-1-(10H-phenothiazin-2-yl)non-2-en-1-one |
| SMILES | CCCCCC(=C/c1ccccc1)/C=C/C(=O)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C28H27NOS/c1-2-3-5-10-22(19-21-11-6-4-7-12-21)15-17-26(30)23-16-18-28-25(20-23)29-24-13-8-9-14-27(24)31-28/h4,6-9,11-20,29H,2-3,5,10H2,1H3/b17-15+,22-19- |
| InChIKey | HUBSPLGWFHBGHJ-WIGISAIBSA-N |
| XLogP | 8.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|