C25H24N2OS — CID 19544437
(E)-3-[4-(diethylamino)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one (PubChem CID 19544437) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is (E)-3-[4-(diethylamino)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(diethylamino)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19544437 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (E)-3-[4-(diethylamino)phenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)c2ccc3c(c2)Nc2ccccc2S3)cc1 |
| InChI | InChI=1S/C25H24N2OS/c1-3-27(4-2)20-13-9-18(10-14-20)11-15-23(28)19-12-16-25-22(17-19)26-21-7-5-6-8-24(21)29-25/h5-17,26H,3-4H2,1-2H3/b15-11+ |
| InChIKey | NWEIERZGUZCBIY-RVDMUPIBSA-N |
| XLogP | 6.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|