C28H24ClN3O2S — CID 19544560
(E)-3-[3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one (PubChem CID 19544560) has the molecular formula C28H24ClN3O2S and a molecular weight of 502.04 g/mol. Its IUPAC name is (E)-3-[3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19544560 |
| Molecular Formula | C28H24ClN3O2S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (E)-3-[3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(10H-phenothiazin-2-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)Nc2ccccc2S3)cc1Cn1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C28H24ClN3O2S/c1-17-28(29)18(2)32(31-17)16-21-14-19(9-12-25(21)34-3)8-11-24(33)20-10-13-27-23(15-20)30-22-6-4-5-7-26(22)35-27/h4-15,30H,16H2,1-3H3/b11-8+ |
| InChIKey | MTKJSDAYDAESOA-DHZHZOJOSA-N |
| XLogP | 7.31 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|