C32H28N2O5S — CID 19544600
2-[2-ethoxy-4-[(E)-3-oxo-3-(10H-phenothiazin-2-yl)prop-1-enyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 19544600) has the molecular formula C32H28N2O5S and a molecular weight of 552.65 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-3-oxo-3-(10H-phenothiazin-2-yl)prop-1-enyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-3-oxo-3-(10H-phenothiazin-2-yl)prop-1-enyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19544600 |
| Molecular Formula | C32H28N2O5S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-3-oxo-3-(10H-phenothiazin-2-yl)prop-1-enyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc3c(c2)Nc2ccccc2S3)ccc1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C32H28N2O5S/c1-3-38-29-18-21(13-16-28(29)39-20-32(36)34-23-8-4-6-10-27(23)37-2)12-15-26(35)22-14-17-31-25(19-22)33-24-9-5-7-11-30(24)40-31/h4-19,33H,3,20H2,1-2H3,(H,34,36)/b15-12+ |
| InChIKey | XNACZQUCIYDKOP-NTCAYCPXSA-N |
| XLogP | 7.22 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|