C16H18N2S — CID 68755312
N,N-diethyl-10H-phenothiazin-3-amine (PubChem CID 68755312) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N,N-diethyl-10H-phenothiazin-3-amine.
| Compound Name | N,N-diethyl-10H-phenothiazin-3-amine |
|---|---|
| PubChem CID | 68755312 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N,N-diethyl-10H-phenothiazin-3-amine |
| SMILES | CCN(CC)c1ccc2c(c1)Sc1ccccc1N2 |
| InChI | InChI=1S/C16H18N2S/c1-3-18(4-2)12-9-10-14-16(11-12)19-15-8-6-5-7-13(15)17-14/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | HQDFRMZVMKJZLX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |