C16H19N3S — CID 170996970
3-N,3-N,7-N,7-N-tetrakis(trideuteriomethyl)-10H-phenothiazine-3,7-diamine (PubChem CID 170996970) has the molecular formula C16H19N3S and a molecular weight of 297.49 g/mol. Its IUPAC name is 3-N,3-N,7-N,7-N-tetrakis(trideuteriomethyl)-10H-phenothiazine-3,7-diamine.
| Compound Name | 3-N,3-N,7-N,7-N-tetrakis(trideuteriomethyl)-10H-phenothiazine-3,7-diamine |
|---|---|
| PubChem CID | 170996970 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 3-N,3-N,7-N,7-N-tetrakis(trideuteriomethyl)-10H-phenothiazine-3,7-diamine |
| SMILES | [2H]C([2H])([2H])N(c1ccc2c(c1)Sc1cc(N(C([2H])([2H])[2H])C([2H])([2H])[2H])ccc1N2)C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H19N3S/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13/h5-10,17H,1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | QTWZICCBKBYHDM-MGKWXGLJSA-N |
| XLogP | 4.03 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |