C18H21N3OS — CID 154159109
1-[3,7-bis(dimethylamino)-10H-phenothiazin-1-yl]ethanone (PubChem CID 154159109) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[3,7-bis(dimethylamino)-10H-phenothiazin-1-yl]ethanone.
| Compound Name | 1-[3,7-bis(dimethylamino)-10H-phenothiazin-1-yl]ethanone |
|---|---|
| PubChem CID | 154159109 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[3,7-bis(dimethylamino)-10H-phenothiazin-1-yl]ethanone |
| SMILES | CC(=O)c1cc(N(C)C)cc2c1Nc1ccc(N(C)C)cc1S2 |
| InChI | InChI=1S/C18H21N3OS/c1-11(22)14-8-13(21(4)5)10-17-18(14)19-15-7-6-12(20(2)3)9-16(15)23-17/h6-10,19H,1-5H3 |
| InChIKey | QJCDGWJNJFPQJG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |