About [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride
[7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride (PubChem CID 68965003) has the molecular formula C16H20ClN3S
and a molecular weight of 321.88 g/mol. Its IUPAC name is [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride.
Molecular Properties
| Compound Name | [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride |
| PubChem CID | 68965003 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride |
| SMILES | CN(C)c1ccc2c(c1)SC1=C(C=CC(=[N+](C)C)C1)N2.[Cl-] |
| InChI | InChI=1S/C16H20N3S.ClH/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;/h5-9,17H,10H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZFHLKHBDVBKUDL-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride?
The IUPAC name of [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride (CID 68965003) is [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride.
What is the SMILES notation for [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride?
The canonical SMILES for [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride is CN(C)c1ccc2c(c1)SC1=C(C=CC(=[N+](C)C)C1)N2.[Cl-].
What is the InChIKey of [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride?
The InChIKey is ZFHLKHBDVBKUDL-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H20N3S.ClH/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;/h5-9,17H,10H2,1-4H3;1H/q+1;/p-1.
What are the key properties of [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride?
[7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride has a molecular weight of 321.88 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride is sourced from PubChem (CID 68965003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).