C16H20ClN3S — CID 68965003
[7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride (PubChem CID 68965003) has the molecular formula C16H20ClN3S and a molecular weight of 321.88 g/mol. Its IUPAC name is [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride.
| Compound Name | [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 68965003 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [7-(dimethylamino)-4,10-dihydrophenothiazin-3-ylidene]-dimethylazanium chloride |
| SMILES | CN(C)c1ccc2c(c1)SC1=C(C=CC(=[N+](C)C)C1)N2.[Cl-] |
| InChI | InChI=1S/C16H20N3S.ClH/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;/h5-9,17H,10H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZFHLKHBDVBKUDL-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|