C15H19Br2N3S — CID 170996966
3-N,7-N,7-N-tris(trideuteriomethyl)-10H-phenothiazine-3,7-diamine;dihydrobromide (PubChem CID 170996966) has the molecular formula C15H19Br2N3S and a molecular weight of 442.27 g/mol. Its IUPAC name is 3-N,7-N,7-N-tris(trideuteriomethyl)-10H-phenothiazine-3,7-diamine;dihydrobromide.
| Compound Name | 3-N,7-N,7-N-tris(trideuteriomethyl)-10H-phenothiazine-3,7-diamine;dihydrobromide |
|---|---|
| PubChem CID | 170996966 |
| Molecular Formula | C15H19Br2N3S |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 3-N,7-N,7-N-tris(trideuteriomethyl)-10H-phenothiazine-3,7-diamine;dihydrobromide |
| SMILES | Br.Br.[2H]C([2H])([2H])Nc1ccc2c(c1)Sc1cc(N(C([2H])([2H])[2H])C([2H])([2H])[2H])ccc1N2 |
| InChI | InChI=1S/C15H17N3S.2BrH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;;/h4-9,16-17H,1-3H3;2*1H/i1D3,2D3,3D3;; |
| InChIKey | XLAYZMZNKUSTSD-VIVYLVLJSA-N |
| XLogP | 5.16 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|