About methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate
methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate (PubChem CID 171100441) has the molecular formula C13H16N2O2S2
and a molecular weight of 296.42 g/mol. Its IUPAC name is methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate.
Molecular Properties
| Compound Name | methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate |
| PubChem CID | 171100441 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate |
| SMILES | CS.O.ONc1ccc2c(c1)Sc1ccccc1N2 |
| InChI | InChI=1S/C12H10N2OS.CH4S.H2O/c15-14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13-10;1-2;/h1-7,13-15H;2H,1H3;1H2 |
| InChIKey | IIFCAGGMFPFTTQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate?
The IUPAC name of methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate (CID 171100441) is methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate.
What is the SMILES notation for methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate?
The canonical SMILES for methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate is CS.O.ONc1ccc2c(c1)Sc1ccccc1N2.
What is the InChIKey of methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate?
The InChIKey is IIFCAGGMFPFTTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2OS.CH4S.H2O/c15-14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13-10;1-2;/h1-7,13-15H;2H,1H3;1H2.
What are the key properties of methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate?
methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate has a molecular weight of 296.42 g/mol, XLogP of 3.42, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;N-(10H-phenothiazin-3-yl)hydroxylamine;hydrate is sourced from PubChem (CID 171100441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).