C15H18IN3S — CID 161338300
3-N,7-N,7-N-trimethyl-10H-phenothiazin-5-ium-3,7-diamine iodide (PubChem CID 161338300) has the molecular formula C15H18IN3S and a molecular weight of 399.30 g/mol. Its IUPAC name is 3-N,7-N,7-N-trimethyl-10H-phenothiazin-5-ium-3,7-diamine iodide.
| Compound Name | 3-N,7-N,7-N-trimethyl-10H-phenothiazin-5-ium-3,7-diamine iodide |
|---|---|
| PubChem CID | 161338300 |
| Molecular Formula | C15H18IN3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 3-N,7-N,7-N-trimethyl-10H-phenothiazin-5-ium-3,7-diamine iodide |
| SMILES | CNc1ccc2c(c1)[SH+]c1cc(N(C)C)ccc1N2.[I-] |
| InChI | InChI=1S/C15H17N3S.HI/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9,16-17H,1-3H3;1H |
| InChIKey | VMIHMSSREZUMPW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|