C23H26O3 — CID 19566856
(E,4Z)-4-benzylidene-1-(4-hydroxy-3-methoxyphenyl)non-2-en-1-one (PubChem CID 19566856) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (E,4Z)-4-benzylidene-1-(4-hydroxy-3-methoxyphenyl)non-2-en-1-one.
| Compound Name | (E,4Z)-4-benzylidene-1-(4-hydroxy-3-methoxyphenyl)non-2-en-1-one |
|---|---|
| PubChem CID | 19566856 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (E,4Z)-4-benzylidene-1-(4-hydroxy-3-methoxyphenyl)non-2-en-1-one |
| SMILES | CCCCCC(=C/c1ccccc1)/C=C/C(=O)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C23H26O3/c1-3-4-6-9-19(16-18-10-7-5-8-11-18)12-14-21(24)20-13-15-22(25)23(17-20)26-2/h5,7-8,10-17,25H,3-4,6,9H2,1-2H3/b14-12+,19-16- |
| InChIKey | QRJCQUKXSPBWRH-ABFFWBDYSA-N |
| XLogP | 5.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|