C19H13FN2O2 — CID 125485189
(E)-1-(4-fluorophenyl)-4-(4-imidazol-1-ylphenyl)but-2-ene-1,4-dione (PubChem CID 125485189) has the molecular formula C19H13FN2O2 and a molecular weight of 320.32 g/mol. Its IUPAC name is (E)-1-(4-fluorophenyl)-4-(4-imidazol-1-ylphenyl)but-2-ene-1,4-dione.
| Compound Name | (E)-1-(4-fluorophenyl)-4-(4-imidazol-1-ylphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 125485189 |
| Molecular Formula | C19H13FN2O2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (E)-1-(4-fluorophenyl)-4-(4-imidazol-1-ylphenyl)but-2-ene-1,4-dione |
| SMILES | O=C(/C=C/C(=O)c1ccc(-n2ccnc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13FN2O2/c20-16-5-1-14(2-6-16)18(23)9-10-19(24)15-3-7-17(8-4-15)22-12-11-21-13-22/h1-13H/b10-9+ |
| InChIKey | AJOZNRZXCLQQDT-MDZDMXLPSA-N |
| XLogP | 3.63 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|