C17H21FO2 — CID 175798929
(E,4E)-4-[(4-fluorophenyl)methylidene]-2-methylnon-2-enoic acid (PubChem CID 175798929) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methylnon-2-enoic acid.
| Compound Name | (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methylnon-2-enoic acid |
|---|---|
| PubChem CID | 175798929 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (E,4E)-4-[(4-fluorophenyl)methylidene]-2-methylnon-2-enoic acid |
| SMILES | CCCCCC(=C\c1ccc(F)cc1)/C=C(\C)C(=O)O |
| InChI | InChI=1S/C17H21FO2/c1-3-4-5-6-15(11-13(2)17(19)20)12-14-7-9-16(18)10-8-14/h7-12H,3-6H2,1-2H3,(H,19,20)/b13-11+,15-12+ |
| InChIKey | PWYRCVZDLNAUEM-CEHLPYKYSA-N |
| XLogP | 4.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|