C21H19NO4 — CID 2235057
(3R)-3-[(2,2-diphenylacetyl)amino]-3-(furan-2-yl)propanoic acid (PubChem CID 2235057) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (3R)-3-[(2,2-diphenylacetyl)amino]-3-(furan-2-yl)propanoic acid.
| Compound Name | (3R)-3-[(2,2-diphenylacetyl)amino]-3-(furan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 2235057 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (3R)-3-[(2,2-diphenylacetyl)amino]-3-(furan-2-yl)propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C21H19NO4/c23-19(24)14-17(18-12-7-13-26-18)22-21(25)20(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-13,17,20H,14H2,(H,22,25)(H,23,24)/t17-/m1/s1 |
| InChIKey | JKXCYTYNXQEUPJ-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |