C12H17NO4S — CID 143634398
(3R)-3-(butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoic acid (PubChem CID 143634398) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (3R)-3-(butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoic acid.
| Compound Name | (3R)-3-(butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 143634398 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (3R)-3-(butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoic acid |
| SMILES | CCCCSC(=O)N[C@H](CC(=O)O)c1ccco1 |
| InChI | InChI=1S/C12H17NO4S/c1-2-3-7-18-12(16)13-9(8-11(14)15)10-5-4-6-17-10/h4-6,9H,2-3,7-8H2,1H3,(H,13,16)(H,14,15)/t9-/m1/s1 |
| InChIKey | KTADFVOLGLKPPO-SECBINFHSA-N |
| XLogP | 3.04 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|