C15H19N3O4 — CID 97202279
(3S)-3-(furan-2-yl)-3-[(1-methyl-3-propylpyrazole-5-carbonyl)amino]propanoic acid (PubChem CID 97202279) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3S)-3-(furan-2-yl)-3-[(1-methyl-3-propylpyrazole-5-carbonyl)amino]propanoic acid.
| Compound Name | (3S)-3-(furan-2-yl)-3-[(1-methyl-3-propylpyrazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 97202279 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3S)-3-(furan-2-yl)-3-[(1-methyl-3-propylpyrazole-5-carbonyl)amino]propanoic acid |
| SMILES | CCCc1cc(C(=O)N[C@@H](CC(=O)O)c2ccco2)n(C)n1 |
| InChI | InChI=1S/C15H19N3O4/c1-3-5-10-8-12(18(2)17-10)15(21)16-11(9-14(19)20)13-6-4-7-22-13/h4,6-8,11H,3,5,9H2,1-2H3,(H,16,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | OIPPCGODFKRSSY-NSHDSACASA-N |
| XLogP | 1.91 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |