C14H16N4O4 — CID 97195064
(3R)-3-[[2-(ethylamino)pyrimidine-5-carbonyl]amino]-3-(furan-2-yl)propanoic acid (PubChem CID 97195064) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is (3R)-3-[[2-(ethylamino)pyrimidine-5-carbonyl]amino]-3-(furan-2-yl)propanoic acid.
| Compound Name | (3R)-3-[[2-(ethylamino)pyrimidine-5-carbonyl]amino]-3-(furan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 97195064 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3R)-3-[[2-(ethylamino)pyrimidine-5-carbonyl]amino]-3-(furan-2-yl)propanoic acid |
| SMILES | CCNc1ncc(C(=O)N[C@H](CC(=O)O)c2ccco2)cn1 |
| InChI | InChI=1S/C14H16N4O4/c1-2-15-14-16-7-9(8-17-14)13(21)18-10(6-12(19)20)11-4-3-5-22-11/h3-5,7-8,10H,2,6H2,1H3,(H,18,21)(H,19,20)(H,15,16,17)/t10-/m1/s1 |
| InChIKey | YGHAPUNUXFEMBW-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |