C13H19NO4S — CID 143642825
methyl (3R)-3-(tert-butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoate (PubChem CID 143642825) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl (3R)-3-(tert-butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoate.
| Compound Name | methyl (3R)-3-(tert-butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 143642825 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl (3R)-3-(tert-butylsulfanylcarbonylamino)-3-(furan-2-yl)propanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)SC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C13H19NO4S/c1-13(2,3)19-12(16)14-9(8-11(15)17-4)10-6-5-7-18-10/h5-7,9H,8H2,1-4H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | DOCZHPNQYUWYFJ-SECBINFHSA-N |
| XLogP | 3.13 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|